|
Organic fluoro-containing chemicals
FT-10(N-Ethyl-N-2-hydroxyethylperfluoro octanesulfonamide)(CAS.:1691-99-2)
CAS No.: 1691-99-2
| Serial number |
A006 |
| Trade name |
FT-10 |
| Chemical name |
N-ethyl-N-perfluorooctylsulfonylaminoethanol |
| structure formula |
CF3(CF2)7SO2N(C2H5)CH2CH2OH |
| Molecular formula |
C12H10F17O3NS |
| Appearance |
Under room temperature , it is white or yellowish waxy solid and turned into amber liquid after being melted. |
| Melting point |
55-65°C |
| Related density @80°C |
1.71g/ml |
| Assay |
≥95% |
| Application |
It is a kind of nonionic fluoro-containg and the intermediate preparing various of fluoro-containg surfactants and surface treating agent. In addition the important material synthesizing perfluoro alkyl acrylate. |
| Package |
500g×20bottle/per box |
| Shipment |
general chemical |
|
