|
Organic fluoro-containing chemicals
FT-922(N-perfluoroalkylsulfonylpropyl triethyloxy silane)(0-0-0)
CAS No.:
| Serial number |
A009 |
| Trade name |
FT-922 |
| Chemical name |
Perfluoroalkylsulfonyl propyl triethyloxy silicane |
| Molecular structure |
C8F17SO2NHCH2CH2CH2Si(OCH2CH3)3 |
| Molecular formula |
C17H22F17O5NSSi |
| Molecular weight |
703.1 |
| Appearance |
Yellowish transparent liquid |
| refractive index@20°C |
1.382(30%) |
| Assay |
50% |
| Application |
Fiuosilicate easily forms a membrane in air, so it is widely used as anti-oil, anti-water, anti-dirt in fields of glass, ceramics, leather fibre, also as demoulding agent and permanent anti-dirt flash paint for WF insulator. |
| Package |
500g×25bottle/per box |
| Shipment |
general chemical |
|
